Difference between revisions of "TRESYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHO-COA DEPHOSPHO-COA] == * common-name: ** 3'-dephospho-coa * smiles: ** cc(c)(cop(=o)([...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=App-his-tRNAs App-his-tRNAs] == * common-name: ** 5'-(5'-diphosphoadenosine)-ribonucleotide-[tr...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHO-COA DEPHOSPHO-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=App-his-tRNAs App-his-tRNAs] ==
 
* common-name:
 
* common-name:
** 3'-dephospho-coa
+
** 5'-(5'-diphosphoadenosine)-ribonucleotide-[trnahis]
* smiles:
 
** cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))))c(o)c(=o)nccc(=o)nccs
 
* inchi-key:
 
** kdtshfargakyjn-ibosznhhsa-l
 
* molecular-weight:
 
** 685.538
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADCPT]]
+
* [[RXN-12504]]
* [[DEPHOSPHOCOAKIN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PANTEPADENYLYLTRAN-RXN]]
+
* [[RXN-12503]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3'-dephospho-coa}}
+
{{#set: common-name=5'-(5'-diphosphoadenosine)-ribonucleotide-[trnahis]}}
{{#set: inchi-key=inchikey=kdtshfargakyjn-ibosznhhsa-l}}
 
{{#set: molecular-weight=685.538}}
 

Revision as of 14:18, 26 August 2019

Metabolite App-his-tRNAs

  • common-name:
    • 5'-(5'-diphosphoadenosine)-ribonucleotide-[trnahis]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "5'-(5'-diphosphoadenosine)-ribonucleotide-[trnahis" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.