Difference between revisions of "TRIGLSYN-PWY"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7061 CPD-7061] ==
+== Pathway TRIGLSYN-PWY ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** pheophorbide a
+** diacylglycerol and triacylglycerol biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c=cc5(=c(c)c6(=cc1(c(c)c(ccc(=o)[o-])c(n=1)=c3([c-](c(oc)=o)c(=o)c2(c(c)=c(nc=23)c=c4(c(cc)=c(c)c(=n4)c=c5n6))))))
+* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
-* inchi-key:
+* [[PHOSPHATIDATE-PHOSPHATASE-RXN]]
-** uxwyeazhzlzdgm-zvevzsnksa-m
+* [[RXN-12959]]
-* molecular-weight:
+* [[RXN-1381]]
-** 590.677
+* [[RXN-1623]]
-== Reaction(s) known to consume the compound ==
+== Reaction(s) not found ==
-* [[RXN-17252]]
+* [NoneRXN-1641 RXN-1641]
-* [[RXN-7740]]
+* [NoneRXN-12383 RXN-12383]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2759}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=diacylglycerol and triacylglycerol biosynthesis}}
-{{#set: common-name=pheophorbide a}}
+{{#set: nb reaction found=5}}
-{{#set: inchi-key=inchikey=uxwyeazhzlzdgm-zvevzsnksa-m}}
+{{#set: completion rate=0.71}}
-{{#set: molecular-weight=590.677}}
+{{#set: nb total reaction=7}}