Difference between revisions of "TRNA-2-thiouridine34"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1130 == * common-name: ** 3-ethylmalate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])o * inchi-key: ** jucrenbzzqkfgk-uhfffaoysa-l * molecu...") |
(Created page with "Category:metabolite == Metabolite tRNA-2-thiouridine34 == * common-name: ** a 2-thiouridine34 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-2-thiouridine34 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2-thiouridine34 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16820]] |
| + | * [[RXN0-2023]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2-thiouridine34 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite tRNA-2-thiouridine34
- common-name:
- a 2-thiouridine34 in trna
