Difference between revisions of "TRNA-2-thiouridine34"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Mannosyl9-Nacetylglucosaminyl2 == == Reaction(s) known to consume the compound == * 3.2.1.113-RXN == Reaction(s) known to produce the...") |
(Created page with "Category:metabolite == Metabolite CPD-1130 == * common-name: ** 3-ethylmalate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])o * inchi-key: ** jucrenbzzqkfgk-uhfffaoysa-l * molecu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-1130 == |
| + | * common-name: | ||
| + | ** 3-ethylmalate | ||
| + | * smiles: | ||
| + | ** ccc(c([o-])=o)c(c(=o)[o-])o | ||
| + | * inchi-key: | ||
| + | ** jucrenbzzqkfgk-uhfffaoysa-l | ||
| + | * molecular-weight: | ||
| + | ** 160.126 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14986]] |
| + | * [[RXN-18210]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18210]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=3-ethylmalate}} | ||
| + | {{#set: inchi-key=inchikey=jucrenbzzqkfgk-uhfffaoysa-l}} | ||
| + | {{#set: molecular-weight=160.126}} | ||
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-1130
- common-name:
- 3-ethylmalate
- smiles:
- ccc(c([o-])=o)c(c(=o)[o-])o
- inchi-key:
- jucrenbzzqkfgk-uhfffaoysa-l
- molecular-weight:
- 160.126
