Difference between revisions of "TRNA-2-thiouridine34"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17399 == * common-name: ** a [glycerolipid]-auricolate == Reaction(s) known to consume the compound == * RXN-16157 == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRIN_IX == * common-name: ** protoporphyrin ix * smiles: ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROTOPORPHYRIN_IX == |
* common-name: | * common-name: | ||
| − | ** | + | ** protoporphyrin ix |
| + | * smiles: | ||
| + | ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5))) | ||
| + | * inchi-key: | ||
| + | ** ksfovussgskxfi-ujjxfscmsa-l | ||
| + | * molecular-weight: | ||
| + | ** 560.651 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[PROTOHEMEFERROCHELAT-RXN]] |
| + | * [[RXN1F-20]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[PPPGO]] |
| − | * [[RXN | + | * [[PROTOHEMEFERROCHELAT-RXN]] |
| + | * [[PROTOPORGENOXI-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=protoporphyrin ix}} |
| + | {{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}} | ||
| + | {{#set: molecular-weight=560.651}} | ||
Revision as of 13:08, 14 January 2021
Contents
Metabolite PROTOPORPHYRIN_IX
- common-name:
- protoporphyrin ix
- smiles:
- c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
- inchi-key:
- ksfovussgskxfi-ujjxfscmsa-l
- molecular-weight:
- 560.651
