Difference between revisions of "TRNA-Adenosines-37"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite QUINOLINATE == * common-name: ** quinolinate * smiles: ** c1(=cc=c(c(c([o-])=o)=n1)c([o-])=o) * inchi-key: ** gjawhxhkyyxbsv-uhfffaoysa-l...") |
(Created page with "Category:metabolite == Metabolite tRNA-Adenosines-37 == * common-name: ** an adenosine37 in trna == Reaction(s) known to consume the compound == * RXN0-6274 == Reactio...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-Adenosines-37 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an adenosine37 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6274]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an adenosine37 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite tRNA-Adenosines-37
- common-name:
- an adenosine37 in trna
