Difference between revisions of "TRNA-Adenosines-37"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15924 == * common-name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o * inchi-k...") |
(Created page with "Category:metabolite == Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH == * common-name: ** 1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate == Reaction(s) known to cons...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH == |
* common-name: | * common-name: | ||
| − | ** 1- | + | ** 1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10958]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.7.1.150-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=1- | + | {{#set: common-name=1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate}} |
| − | |||
| − | |||
Revision as of 15:28, 5 January 2021
Contents
Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH
- common-name:
- 1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate
