Difference between revisions of "TRNA-Adenosines-37"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ11978 == * transcription-direction: ** positive * right-end-position: ** 11682 * left-end-position: ** 5832 * centisome-position: ** 1.6083218...")
(Created page with "Category:metabolite == Metabolite CPD-15924 == * common-name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o * inchi-k...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ11978 ==
+
== Metabolite CPD-15924 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 1-oleoyl-2-lyso-glycerone phosphate
−
* right-end-position:
+
* smiles:
−
** 11682
+
** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o
−
* left-end-position:
+
* inchi-key:
−
** 5832
+
** yzkfnnqaebncen-ktkrtigzsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 1.6083218   
+
** 432.493
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-15044]]
−
* [[RXN0-6377]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=1-oleoyl-2-lyso-glycerone phosphate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=yzkfnnqaebncen-ktkrtigzsa-l}}
−
== Pathway(s) associated ==
+
{{#set: molecular-weight=432.493}}
−
* [[PWY-723]]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-5675]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=11682}}
 
−
{{#set: left-end-position=5832}}
 
−
{{#set: centisome-position=1.6083218    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-15924

  • common-name:
    • 1-oleoyl-2-lyso-glycerone phosphate
  • smiles:
    • ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o
  • inchi-key:
    • yzkfnnqaebncen-ktkrtigzsa-l
  • molecular-weight:
    • 432.493

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNA-Adenosines-37&oldid=47327"