Difference between revisions of "TRNA-CHARGING-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1...")
(Created page with "Category:pathway == Pathway TRNA-CHARGING-PWY == * taxonomic-range: ** tax-2759 ** tax-2 ** tax-2157 * common-name: ** trna charging == Reaction(s) found == <div class="to...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] ==
+
== Pathway TRNA-CHARGING-PWY ==
 +
* taxonomic-range:
 +
** tax-2759
 +
** tax-2
 +
** tax-2157
 
* common-name:
 
* common-name:
−
** ribose-1-arsenate
+
** trna charging
−
* smiles:
+
== Reaction(s) found ==
−
** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* inchi-key:
+
* [[ALANINE--TRNA-LIGASE-RXN]]
−
** ryjjomqpaaufbf-txicztdvsa-l
+
* [[ARGININE--TRNA-LIGASE-RXN]]
−
* molecular-weight:
+
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
−
** 272.043
+
* [[ASPARTATE--TRNA-LIGASE-RXN]]
−
== Reaction(s) known to consume the compound ==
+
* [[CYSTEINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
* [[GLURS-RXN]]
−
* [[RXN-7001]]
+
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
* [[GLYCINE--TRNA-LIGASE-RXN]]
−
{{#set: common-name=ribose-1-arsenate}}
+
* [[HISTIDINE--TRNA-LIGASE-RXN]]
−
{{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}}
+
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
−
{{#set: molecular-weight=272.043}}
+
* [[LEUCINE--TRNA-LIGASE-RXN]]
 +
* [[LYSINE--TRNA-LIGASE-RXN]]
 +
* [[METHIONINE--TRNA-LIGASE-RXN]]
 +
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 +
* [[PROLINE--TRNA-LIGASE-RXN]]
 +
* [[RXN-16165]]
 +
* [[SERINE--TRNA-LIGASE-RXN]]
 +
* [[THREONINE--TRNA-LIGASE-RXN]]
 +
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 +
* [[TYROSINE--TRNA-LIGASE-RXN]]
 +
* [[VALINE--TRNA-LIGASE-RXN]]
 +
</div>
 +
== Reaction(s) not found ==
 +
All reactions of this pathways are in present
 +
{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
 +
{{#set: common-name=trna charging}}
 +
{{#set: nb reaction found=21}}
 +
{{#set: completion rate=1.0}}
 +
{{#set: nb total reaction=21}}

Latest revision as of 11:00, 18 March 2021

Pathway TRNA-CHARGING-PWY

  • taxonomic-range:
    • tax-2759
    • tax-2
    • tax-2157
  • common-name:
    • trna charging

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNA-CHARGING-PWY&oldid=131404"