Difference between revisions of "TRNA-CHARGING-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-A CHLOROPHYLL-A] == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)occ=c(c)cccc(c)ccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] == * common-name: ** ribose-1-arsenate * smiles: ** c(o)c1...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] == |
+ | * common-name: | ||
+ | ** ribose-1-arsenate | ||
* smiles: | * smiles: | ||
− | ** c | + | ** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1) |
− | * | + | * inchi-key: |
− | ** | + | ** ryjjomqpaaufbf-txicztdvsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 272.043 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-7001]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=ribose-1-arsenate}} |
− | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}} |
+ | {{#set: molecular-weight=272.043}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite RIBOSE-1-ARSENATE
- common-name:
- ribose-1-arsenate
- smiles:
- c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
- inchi-key:
- ryjjomqpaaufbf-txicztdvsa-l
- molecular-weight:
- 272.043