Difference between revisions of "TRNA-Containing-N1-MethylAdenine-58"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-178 RXN3O-178] == * direction: ** left-to-right * common-name: ** sam:c-24 sterol methyltrans...")
(Created page with "Category:metabolite == Metabolite HOMO-CIT == * common-name: ** (2r)-homocitrate * smiles: ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o * inchi-key: ** xkjvevrqmlksmo-ssdotts...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-178 RXN3O-178] ==
+
== Metabolite HOMO-CIT ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** sam:c-24 sterol methyltransferase
+
** (2r)-homocitrate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.41 ec-2.1.1.41]
+
** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
== Reaction formula ==
+
* inchi-key:
* 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[ZYMOSTEROL]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[FECOSTEROL]][c] '''+''' 1 [[PROTON]][c]
+
** xkjvevrqmlksmo-ssdottswsa-k
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ05905]]
+
** 203.128
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13722]]
* Gene: [[SJ09766]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-13722]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=(2r)-homocitrate}}
* [[PWY-6075]], ergosterol biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6075 PWY-6075]
+
{{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}}
** '''3''' reactions found over '''5''' reactions in the full pathway
+
{{#set: molecular-weight=203.128}}
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21129 21129]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R04427 R04427]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P25087 P25087]
 
** [http://www.uniprot.org/uniprot/Q39227 Q39227]
 
** [http://www.uniprot.org/uniprot/O49215 O49215]
 
** [http://www.uniprot.org/uniprot/O24153 O24153]
 
** [http://www.uniprot.org/uniprot/O24154 O24154]
 
** [http://www.uniprot.org/uniprot/P93852 P93852]
 
** [http://www.uniprot.org/uniprot/Q43445 Q43445]
 
** [http://www.uniprot.org/uniprot/Q41586 Q41586]
 
** [http://www.uniprot.org/uniprot/O24328 O24328]
 
** [http://www.uniprot.org/uniprot/O14321 O14321]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=sam:c-24 sterol methyltransferase}}
 
{{#set: ec-number=ec-2.1.1.41}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:35, 18 December 2020

Metabolite HOMO-CIT

  • common-name:
    • (2r)-homocitrate
  • smiles:
    • c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
  • inchi-key:
    • xkjvevrqmlksmo-ssdottswsa-k
  • molecular-weight:
    • 203.128

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality