Difference between revisions of "TRNA-Containing-N1-MethylAdenine-58"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-590 == * common-name: ** (2r,3s,4s)-leucocyanidin * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)o)o)o)))=cc(o)=c(c=3)o) * inchi-key: ** s...") |
(Created page with "Category:metabolite == Metabolite L-arabinopyranose == == Reaction(s) known to consume the compound == * RXN-8772 == Reaction(s) known to produce the compound == * R...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-arabinopyranose == |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8772]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8772]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
