Difference between revisions of "TRNA-Containing-N1-Methylguanine-37"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-2742 == * common-name: ** cotinine * smiles: ** c1(=o)(cc[ch](n(c)1)c2(c=nc=cc=2)) * inchi-key: ** uikrocxwunqspj-vifpvbqesa-n * mole...") |
(Created page with "Category:metabolite == Metabolite CPD-15153 == * common-name: ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15153 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** flybtlrocqbhmr-kfsstaeesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 697.095 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14177]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=flybtlrocqbhmr-kfsstaeesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=697.095}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-15153
- common-name:
- 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1)
- inchi-key:
- flybtlrocqbhmr-kfsstaeesa-n
- molecular-weight:
- 697.095
