Difference between revisions of "TRNA-Containing-N1-Methylguanine-37"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15153 == * common-name: ** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N1-Methylguanine-37 == * common-name: ** an n1-methylguanine37 in trna == Reaction(s) known to consume the compound == ==...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-15153 ==
+
== Metabolite tRNA-Containing-N1-Methylguanine-37 ==
 
* common-name:
 
* common-name:
−
** 3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone
+
** an n1-methylguanine37 in trna
−
* smiles:
 
−
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c(c)=1)
 
−
* inchi-key:
 
−
** flybtlrocqbhmr-kfsstaeesa-n
 
−
* molecular-weight:
 
−
** 697.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14177]]
+
* [[RXN-12458]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-methyl-6-methoxy-2-octaprenyl-1,4-benzoquinone}}
+
{{#set: common-name=an n1-methylguanine37 in trna}}
−
{{#set: inchi-key=inchikey=flybtlrocqbhmr-kfsstaeesa-n}}
 
−
{{#set: molecular-weight=697.095}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite tRNA-Containing-N1-Methylguanine-37

  • common-name:
    • an n1-methylguanine37 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNA-Containing-N1-Methylguanine-37&oldid=139604"