Difference between revisions of "TRNA-Containing-N1-Methylguanine-9"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18263 == * transcription-direction: ** positive * right-end-position: ** 170959 * left-end-position: ** 159918 * centisome-position: ** 64.25377...")
(Created page with "Category:metabolite == Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET == * common-name: ** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol * smiles: ** cc...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ18263 ==
+
== Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
−
* right-end-position:
+
* smiles:
−
** 170959
+
** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 159918
+
** htjxtkbiuvfuar-xhibxcghsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 64.25377   
+
** 597.259
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-302]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.7.11.25-RXN]]
+
* [[2.7.1.148-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
−
* [[PROTEIN-KINASE-RXN]]
+
{{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=597.259}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=170959}}
 
−
{{#set: left-end-position=159918}}
 
−
{{#set: centisome-position=64.25377    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 

Revision as of 20:33, 18 December 2020

Metabolite 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET

  • common-name:
    • 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
  • smiles:
    • cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
  • inchi-key:
    • htjxtkbiuvfuar-xhibxcghsa-j
  • molecular-weight:
    • 597.259

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNA-Containing-N1-Methylguanine-9&oldid=46966"