Difference between revisions of "TRNA-Containing-N2-DiMeGua-26-DiMeGua27"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MEVALONATE == * common-name: ** (r)-mevalonate * smiles: ** cc(o)(cco)cc(=o)[o-] * inchi-key: ** kjtlqquupvsxim-zcfiwibfsa-m * molecular-...") |
(Created page with "Category:metabolite == Metabolite CGMP == * common-name: ** cyclic-gmp * smiles: ** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-])) * inchi-key: ** zoogrgp...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CGMP == |
* common-name: | * common-name: | ||
| − | ** | + | ** cyclic-gmp |
* smiles: | * smiles: | ||
| − | ** | + | ** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-])) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zoogrgpoevqqdx-uuokfmhzsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 344.2 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GUANYLCYC-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cyclic-gmp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zoogrgpoevqqdx-uuokfmhzsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=344.2}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CGMP
- common-name:
- cyclic-gmp
- smiles:
- c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-]))
- inchi-key:
- zoogrgpoevqqdx-uuokfmhzsa-m
- molecular-weight:
- 344.2
