Difference between revisions of "TRNA-Containing-N2-DiMeGua-26-DiMeGua27"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CGMP == * common-name: ** cyclic-gmp * smiles: ** c4(c3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)op(o4)(=o)[o-])) * inchi-key: ** zoogrgp...") |
(Created page with "Category:metabolite == Metabolite DODECANOATE == * common-name: ** laurate * smiles: ** cccccccccccc([o-])=o * inchi-key: ** poulhzvokoajma-uhfffaoysa-m * molecular-weight...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DODECANOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** laurate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** poulhzvokoajma-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 199.312 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16393]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.2.21-RXN]] |
| + | * [[RXN-16654]] | ||
| + | * [[RXN-9627]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=laurate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=poulhzvokoajma-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=199.312}} |
Revision as of 18:56, 14 January 2021
Contents
Metabolite DODECANOATE
- common-name:
- laurate
- smiles:
- cccccccccccc([o-])=o
- inchi-key:
- poulhzvokoajma-uhfffaoysa-m
- molecular-weight:
- 199.312
