Difference between revisions of "TRNA-Containing-N2-Dimethylgua-26-Gua27"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13377 == * common-name: ** xlxg xyloglucan oligosaccharide * smiles: ** c8(c(c(c(c(occ7(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Dimethylgua-26-Gua27 == * common-name: ** an n2 dimethylguanine26/guanine27 in trna == Reaction(s) known to consume th...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13377 ==
+
== Metabolite tRNA-Containing-N2-Dimethylgua-26-Gua27 ==
 
* common-name:
 
* common-name:
** xlxg xyloglucan oligosaccharide
+
** an n2 dimethylguanine26/guanine27 in trna
* smiles:
 
** c8(c(c(c(c(occ7(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(c(c(c(o2)co)o)o)o)))3)oc5(c(o)c(o)c(oc(coc4(c(c(c(co4)o)o)o))5)oc6(c(o)c(o)c(o)oc(co)6))))c(o)c(o)c(o)7))o8)o)o)o)
 
* inchi-key:
 
** kbczexdvbxuvgr-ikgyadnmsa-n
 
* molecular-weight:
 
** 1225.073
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12399]]
+
* [[RXN-12380]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12379]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xlxg xyloglucan oligosaccharide}}
+
{{#set: common-name=an n2 dimethylguanine26/guanine27 in trna}}
{{#set: inchi-key=inchikey=kbczexdvbxuvgr-ikgyadnmsa-n}}
 
{{#set: molecular-weight=1225.073}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite tRNA-Containing-N2-Dimethylgua-26-Gua27

  • common-name:
    • an n2 dimethylguanine26/guanine27 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality