Difference between revisions of "TRNA-Containing-N2-Methylgua-26-Gua27"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-PARATHION == * common-name: ** amino-parathion * smiles: ** ccop(oc1(c=cc(=cc=1)n))(occ)=s * inchi-key: ** xizotxgjxstqdi-uhfffaoys...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Methylgua-26-Gua27 == * common-name: ** an n2-methylguanine26/guanine27 in trna == Reaction(s) known to consume the co...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMINO-PARATHION ==
+
== Metabolite tRNA-Containing-N2-Methylgua-26-Gua27 ==
 
* common-name:
 
* common-name:
** amino-parathion
+
** an n2-methylguanine26/guanine27 in trna
* smiles:
 
** ccop(oc1(c=cc(=cc=1)n))(occ)=s
 
* inchi-key:
 
** xizotxgjxstqdi-uhfffaoysa-n
 
* molecular-weight:
 
** 261.275
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AMINOPARATHION-PHOSPHATASE-RXN]]
+
* [[RXN-12379]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12378]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=amino-parathion}}
+
{{#set: common-name=an n2-methylguanine26/guanine27 in trna}}
{{#set: inchi-key=inchikey=xizotxgjxstqdi-uhfffaoysa-n}}
 
{{#set: molecular-weight=261.275}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite tRNA-Containing-N2-Methylgua-26-Gua27

  • common-name:
    • an n2-methylguanine26/guanine27 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality