Difference between revisions of "TRNA-Containing-N2-Methylguanine-26"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11712 == * common-name: ** 2-methyl-6-geranylgeranyl-1,4-benzoquinol * smiles: ** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))...")
(Created page with "Category:metabolite == Metabolite CPD-14758 == * common-name: ** furfuryl thiol * smiles: ** c1(oc(cs)=cc=1) * inchi-key: ** zfftzdqkixpdaf-uhfffaoysa-n * molecular-weight...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11712 ==
+
== Metabolite CPD-14758 ==
 
* common-name:
 
* common-name:
** 2-methyl-6-geranylgeranyl-1,4-benzoquinol
+
** furfuryl thiol
 
* smiles:
 
* smiles:
** cc(=cccc(c)=cccc(=cccc(c)=ccc1(=c(o)c(c)=cc(o)=c1))c)c
+
** c1(oc(cs)=cc=1)
 
* inchi-key:
 
* inchi-key:
** dowccbnjuzolrj-mlagypmbsa-n
+
** zfftzdqkixpdaf-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 396.612
+
** 114.162
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14917]]
+
* [[RXN-13727]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14929]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methyl-6-geranylgeranyl-1,4-benzoquinol}}
+
{{#set: common-name=furfuryl thiol}}
{{#set: inchi-key=inchikey=dowccbnjuzolrj-mlagypmbsa-n}}
+
{{#set: inchi-key=inchikey=zfftzdqkixpdaf-uhfffaoysa-n}}
{{#set: molecular-weight=396.612}}
+
{{#set: molecular-weight=114.162}}

Revision as of 11:17, 15 January 2021

Metabolite CPD-14758

  • common-name:
    • furfuryl thiol
  • smiles:
    • c1(oc(cs)=cc=1)
  • inchi-key:
    • zfftzdqkixpdaf-uhfffaoysa-n
  • molecular-weight:
    • 114.162

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality