Difference between revisions of "TRNA-Containing-N2-Methylguanine-26"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NMNH == * common-name: ** reduced β-nicotinamide d-ribonucleotide * smiles: ** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o...")
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N2-Methylguanine-26 == * common-name: ** an n2-methylguanine26 in trna == Reaction(s) known to consume the compound == *...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NMNH ==
+
== Metabolite tRNA-Containing-N2-Methylguanine-26 ==
 
* common-name:
 
* common-name:
** reduced β-nicotinamide d-ribonucleotide
+
** an n2-methylguanine26 in trna
* smiles:
 
** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o)
 
* inchi-key:
 
** xqhmusrslnrvga-turqnecasa-l
 
* molecular-weight:
 
** 334.222
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12376]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-4401]]
+
* [[RXN-12375]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=reduced β-nicotinamide d-ribonucleotide}}
+
{{#set: common-name=an n2-methylguanine26 in trna}}
{{#set: inchi-key=inchikey=xqhmusrslnrvga-turqnecasa-l}}
 
{{#set: molecular-weight=334.222}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite tRNA-Containing-N2-Methylguanine-26

  • common-name:
    • an n2-methylguanine26 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality