Difference between revisions of "TRNA-Containing-N2-dimethylguanine-26"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-with-5-taurinomethyl-2-thiouridine == * common-name: ** a 5-taurinomethyl-2-thiouridine in trna == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite CPD-18666 == * common-name: ** epoxypheophorbide a * smiles: ** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-with-5-taurinomethyl-2-thiouridine ==
+
== Metabolite CPD-18666 ==
 
* common-name:
 
* common-name:
** a 5-taurinomethyl-2-thiouridine in trna
+
** epoxypheophorbide a
 +
* smiles:
 +
** ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
 +
* inchi-key:
 +
** zmtpzdvbgynplz-ygowezgdsa-m
 +
* molecular-weight:
 +
** 606.677
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16821]]
+
* [[RXN-17252]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5-taurinomethyl-2-thiouridine in trna}}
+
{{#set: common-name=epoxypheophorbide a}}
 +
{{#set: inchi-key=inchikey=zmtpzdvbgynplz-ygowezgdsa-m}}
 +
{{#set: molecular-weight=606.677}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-18666

  • common-name:
    • epoxypheophorbide a
  • smiles:
    • ccc1(=c(c)c3(=nc1=cc6(=c(c)c7(c(=o)[c-](c(oc)=o)c(=c2(c(ccc(=o)[o-])c(c)c(=n2)c=c5(c(c)=c(c=c)c4(oc34)(n5))))c(n6)=7))))
  • inchi-key:
    • zmtpzdvbgynplz-ygowezgdsa-m
  • molecular-weight:
    • 606.677

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality