Difference between revisions of "TRNA-Containing-N2-dimethylguanine-26"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14860 == * transcription-direction: ** positive * right-end-position: ** 81629 * left-end-position: ** 72814 * centisome-position: ** 16.891966...")
(Created page with "Category:metabolite == Metabolite CPD-15369 == * common-name: ** 3r-hydroxy-lesqueroloyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(o...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14860 ==
+
== Metabolite CPD-15369 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3r-hydroxy-lesqueroloyl-coa
−
* right-end-position:
+
* smiles:
−
** 81629
+
** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 72814
+
** chmqnmkvoyfhhx-sgpqcwjrsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 16.891966   
+
** 1088.005
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14494]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
+
* [[RXN-14493]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3r-hydroxy-lesqueroloyl-coa}}
−
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
+
{{#set: inchi-key=inchikey=chmqnmkvoyfhhx-sgpqcwjrsa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=1088.005}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-1001]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=81629}}
 
−
{{#set: left-end-position=72814}}
 
−
{{#set: centisome-position=16.891966    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-15369

  • common-name:
    • 3r-hydroxy-lesqueroloyl-coa
  • smiles:
    • ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • chmqnmkvoyfhhx-sgpqcwjrsa-j
  • molecular-weight:
    • 1088.005

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNA-Containing-N2-dimethylguanine-26&oldid=47103"