Difference between revisions of "TRNA-Dihydrouridines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14158 == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))...")
(Created page with "Category:metabolite == Metabolite ETHYLENE-CMPD == * common-name: ** ethene * smiles: ** c=c * inchi-key: ** vggsqfucumxweo-uhfffaoysa-n * molecular-weight: ** 28.054 == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14158 ==
+
== Metabolite ETHYLENE-CMPD ==
 
* common-name:
 
* common-name:
** nebramycin 5'
+
** ethene
 
* smiles:
 
* smiles:
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
+
** c=c
 
* inchi-key:
 
* inchi-key:
** yppfejhohnpklt-pbsuhmdjsa-s
+
** vggsqfucumxweo-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 515.583
+
** 28.054
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13168]]
+
* [[ETHYL-RXN]]
* [[RXN-15284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nebramycin 5'}}
+
{{#set: common-name=ethene}}
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
+
{{#set: inchi-key=inchikey=vggsqfucumxweo-uhfffaoysa-n}}
{{#set: molecular-weight=515.583}}
+
{{#set: molecular-weight=28.054}}

Revision as of 11:13, 15 January 2021

Metabolite ETHYLENE-CMPD

  • common-name:
    • ethene
  • smiles:
    • c=c
  • inchi-key:
    • vggsqfucumxweo-uhfffaoysa-n
  • molecular-weight:
    • 28.054

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality