Difference between revisions of "TRNA-Dihydrouridines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14158 == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))...")
(Created page with "Category:metabolite == Metabolite tRNA-Dihydrouridines == * common-name: ** a 5,6-dihydrouridine in trna == Reaction(s) known to consume the compound == == Reaction(s) kno...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14158 ==
+
== Metabolite tRNA-Dihydrouridines ==
 
* common-name:
 
* common-name:
** nebramycin 5'
+
** a 5,6-dihydrouridine in trna
* smiles:
 
** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
 
* inchi-key:
 
** yppfejhohnpklt-pbsuhmdjsa-s
 
* molecular-weight:
 
** 515.583
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13168]]
+
* [[RXN0-1281]]
* [[RXN-15284]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=nebramycin 5'}}
+
{{#set: common-name=a 5,6-dihydrouridine in trna}}
{{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}}
 
{{#set: molecular-weight=515.583}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite tRNA-Dihydrouridines

  • common-name:
    • a 5,6-dihydrouridine in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality