Difference between revisions of "TRNA-Dihydrouridines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RNA-Holder == * common-name: ** a ribonucleic acid == Reaction(s) known to consume the compound == * 3.1.27.1-RXN * 3.1.27.5-RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-14158 == * common-name: ** nebramycin 5' * smiles: ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-14158 == |
* common-name: | * common-name: | ||
| − | ** | + | ** nebramycin 5' |
| + | * smiles: | ||
| + | ** c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o) | ||
| + | * inchi-key: | ||
| + | ** yppfejhohnpklt-pbsuhmdjsa-s | ||
| + | * molecular-weight: | ||
| + | ** 515.583 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13168]] |
| − | + | * [[RXN-15284]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=nebramycin 5'}} |
| + | {{#set: inchi-key=inchikey=yppfejhohnpklt-pbsuhmdjsa-s}} | ||
| + | {{#set: molecular-weight=515.583}} | ||
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-14158
- common-name:
- nebramycin 5'
- smiles:
- c([n+])c1(c(cc(c(o1)oc2(c(c(c([n+])cc([n+])2)oc3(oc(c(c(c(o)3)[n+])o)coc(=o)n))o))[n+])o)
- inchi-key:
- yppfejhohnpklt-pbsuhmdjsa-s
- molecular-weight:
- 515.583
