Difference between revisions of "TRNA-containing-5-taurinomethyluridine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10244 == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] * inchi-key: ** mbmbgcfofbjsgt-kubavdmb...") |
(Created page with "Category:metabolite == Metabolite tRNA-containing-5-taurinomethyluridine == * common-name: ** a 5-taurinomethyluridine in trna == Reaction(s) known to consume the compound...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-containing-5-taurinomethyluridine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5-taurinomethyluridine in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16821]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5-taurinomethyluridine in trna}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite tRNA-containing-5-taurinomethyluridine
- common-name:
- a 5-taurinomethyluridine in trna
