Difference between revisions of "TRNA-containing-5-taurinomethyluridine"

Revision as of 15:30, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-10244 ==
+== Metabolite Ubiquinols ==
 * common-name:
-** docosahexaenoate
+** an ubiquinol
-* smiles:
-** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-]
-* inchi-key:
-** mbmbgcfofbjsgt-kubavdmbsa-m
-* molecular-weight:
-** 327.486
 == Reaction(s) known to consume the compound ==
-* [[RXN-16063]]
+* [[1.10.2.2-RXN]]
+* [[1.5.5.1-RXN]]
+* [[NADH-DEHYDROG-A-RXN]]
+* [[RXN-6883]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-16017]]
+* [[1.10.2.2-RXN]]
-* [[RXN-16063]]
+* [[1.5.5.1-RXN]]
-* [[RXN-16138]]
+* [[NADH-DEHYDROG-A-RXN]]
+* [[RXN-11758]]
+* [[RXN-15829]]
+* [[RXN0-5260]]
+* [[RXN0-5330]]
+* [[RXN0-6491]]
+* [[RXN0-7008]]
+* [[RXN66-542]]
+* [[RXN66-550]]
+* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=docosahexaenoate}}
+{{#set: common-name=an ubiquinol}}
-{{#set: inchi-key=inchikey=mbmbgcfofbjsgt-kubavdmbsa-m}}
-{{#set: molecular-weight=327.486}}