Difference between revisions of "TRNA-fragment"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11715 == * common-name: ** phenylacetylglycine * smiles: ** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1) * inchi-key: ** utyvdvlmyqplqb-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite tRNA-fragment == * common-name: ** a trna fragment == Reaction(s) known to consume the compound == == Reaction(s) known to produce the co...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite tRNA-fragment == |
* common-name: | * common-name: | ||
− | ** | + | ** a trna fragment |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[3.1.26.5-RXN]] |
+ | * [[RXN0-6480]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a trna fragment}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite tRNA-fragment
- common-name:
- a trna fragment