Difference between revisions of "TRNA-fragment"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04338 == * transcription-direction: ** negative * right-end-position: ** 750420 * left-end-position: ** 740606 * centisome-position: ** 76.102356...") |
(Created page with "Category:metabolite == Metabolite CPD-11715 == * common-name: ** phenylacetylglycine * smiles: ** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1) * inchi-key: ** utyvdvlmyqplqb-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11715 == |
| − | * | + | * common-name: |
| − | ** | + | ** phenylacetylglycine |
| − | * | + | * smiles: |
| − | ** | + | ** c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1) |
| − | * | + | * inchi-key: |
| − | ** | + | ** utyvdvlmyqplqb-uhfffaoysa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 192.194 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-10821]] |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=phenylacetylglycine}} | |
| − | + | {{#set: inchi-key=inchikey=utyvdvlmyqplqb-uhfffaoysa-m}} | |
| − | + | {{#set: molecular-weight=192.194}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-11715
- common-name:
- phenylacetylglycine
- smiles:
- c(=o)(ncc(=o)[o-])cc1(c=cc=cc=1)
- inchi-key:
- utyvdvlmyqplqb-uhfffaoysa-m
- molecular-weight:
- 192.194
