Difference between revisions of "TRNA-precursors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Retinols == * common-name: ** a retinol == Reaction(s) known to consume the compound == * RETINOLSAT == Reaction(s) known to produce...")
(Created page with "Category:metabolite == Metabolite CPD-14405 == * common-name: ** 3r-hydroxy-dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Retinols ==
+
== Metabolite CPD-14405 ==
 
* common-name:
 
* common-name:
** a retinol
+
** 3r-hydroxy-dihomo γ-linolenoyl-coa
 +
* smiles:
 +
** cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** gfvfsxuaklzogc-nulwuihisa-j
 +
* molecular-weight:
 +
** 1067.974
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RETINOLSAT]]
+
* [[RXN-12969]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
+
* [[RXN-12968]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a retinol}}
+
{{#set: common-name=3r-hydroxy-dihomo γ-linolenoyl-coa}}
 +
{{#set: inchi-key=inchikey=gfvfsxuaklzogc-nulwuihisa-j}}
 +
{{#set: molecular-weight=1067.974}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-14405

  • common-name:
    • 3r-hydroxy-dihomo γ-linolenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • gfvfsxuaklzogc-nulwuihisa-j
  • molecular-weight:
    • 1067.974

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality