Difference between revisions of "TRNA-pseudouridine-38-40"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite IMINOASPARTATE == * common-name: ** 2-iminosuccinate * smiles: ** c(=o)([o-])cc(=n)c(=o)[o-] * inchi-key: ** nmuoatvllqeyhi-uhfffaoysa-l...")
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine-38-40 == * common-name: ** a pseudouridine38-40 in trna == Reaction(s) known to consume the compound == == Reaction(s)...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite IMINOASPARTATE ==
+
== Metabolite tRNA-pseudouridine-38-40 ==
 
* common-name:
 
* common-name:
** 2-iminosuccinate
+
** a pseudouridine38-40 in trna
* smiles:
 
** c(=o)([o-])cc(=n)c(=o)[o-]
 
* inchi-key:
 
** nmuoatvllqeyhi-uhfffaoysa-l
 
* molecular-weight:
 
** 129.072
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[QUINOLINATE-SYNTHA-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[L-ASPARTATE-OXID-RXN]]
+
* [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
* [[RXN-9772]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-iminosuccinate}}
+
{{#set: common-name=a pseudouridine38-40 in trna}}
{{#set: inchi-key=inchikey=nmuoatvllqeyhi-uhfffaoysa-l}}
 
{{#set: molecular-weight=129.072}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite tRNA-pseudouridine-38-40

  • common-name:
    • a pseudouridine38-40 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality