Difference between revisions of "TRNA-pseudouridine13"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE == * common-name: ** cis-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgx...")
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine13 == * common-name: ** a pseudouridine13 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-CARBOXYMETHYLENEBUT-2-EN-4-OLIDE ==
+
== Metabolite tRNA-pseudouridine13 ==
 
* common-name:
 
* common-name:
** cis-dienelactone
+
** a pseudouridine13 in trna
* smiles:
 
** c1(=cc(=o)oc(=cc(=o)[o-])1)
 
* inchi-key:
 
** ayfxpgxazmfwnh-arjawskdsa-m
 
* molecular-weight:
 
** 139.087
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11841]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-dienelactone}}
+
{{#set: common-name=a pseudouridine13 in trna}}
{{#set: inchi-key=inchikey=ayfxpgxazmfwnh-arjawskdsa-m}}
 
{{#set: molecular-weight=139.087}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite tRNA-pseudouridine13

  • common-name:
    • a pseudouridine13 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality