Difference between revisions of "TRNA-pseudouridine13"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite O-PHOSPHO-L-HOMOSERINE == * common-name: ** o-phospho-l-homoserine * smiles: ** c(cop([o-])(=o)[o-])c([n+])c([o-])=o * inchi-key: ** fxdn...")
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine13 == * common-name: ** a pseudouridine13 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite O-PHOSPHO-L-HOMOSERINE ==
+
== Metabolite tRNA-pseudouridine13 ==
 
* common-name:
 
* common-name:
** o-phospho-l-homoserine
+
** a pseudouridine13 in trna
* smiles:
 
** c(cop([o-])(=o)[o-])c([n+])c([o-])=o
 
* inchi-key:
 
** fxdnyoanaxwzhg-vkhmyheasa-l
 
* molecular-weight:
 
** 197.084
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSPH-RXN]]
 
* [[RXN-12728]]
 
* [[THRESYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HOMOSERKIN-RXN]]
+
* [[RXN-11841]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-phospho-l-homoserine}}
+
{{#set: common-name=a pseudouridine13 in trna}}
{{#set: inchi-key=inchikey=fxdnyoanaxwzhg-vkhmyheasa-l}}
 
{{#set: molecular-weight=197.084}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite tRNA-pseudouridine13

  • common-name:
    • a pseudouridine13 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality