Difference between revisions of "TRNA-pseudouridine13"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-PHOSPHO-L-HOMOSERINE == * common-name: ** o-phospho-l-homoserine * smiles: ** c(cop([o-])(=o)[o-])c([n+])c([o-])=o * inchi-key: ** fxdn...") |
(Created page with "Category:metabolite == Metabolite CPD-17271 == * common-name: ** 1-stearoyl-2-palmitoyl-glycerol * smiles: ** cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o * inchi-ke...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-17271 == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-stearoyl-2-palmitoyl-glycerol |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vyqdalbeqrzdpl-dhujradrsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 596.973 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]] |
− | * [[RXN- | + | * [[RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.]] |
− | * [[ | + | * [[RXN-16030]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.]] |
+ | * [[RXN-16030]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-stearoyl-2-palmitoyl-glycerol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vyqdalbeqrzdpl-dhujradrsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=596.973}} |
Revision as of 18:55, 14 January 2021
Contents
Metabolite CPD-17271
- common-name:
- 1-stearoyl-2-palmitoyl-glycerol
- smiles:
- cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)co)=o
- inchi-key:
- vyqdalbeqrzdpl-dhujradrsa-n
- molecular-weight:
- 596.973
Reaction(s) known to consume the compound
- 2-ACYLGLYCEROL-O-ACYLTRANSFERASE-RXN-CPD66-43/STEAROYL-COA//CPD-17271/CO-A.38.
- RXN-1602-CPD-17271/WATER//CPD66-43/STEARIC_ACID/PROTON.46.
- RXN-16030