Difference between revisions of "TRNA-pseudouridine65"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DETHIOBIOTIN == * common-name: ** dethiobiotin * smiles: ** cc1(nc(=o)nc1cccccc(=o)[o-]) * inchi-key: ** autolbmxddtrrt-uhfffaoysa-m * mo...")
(Created page with "Category:metabolite == Metabolite Demethylated-Ubiquinols == * common-name: ** a demethylated ubiquinol == Reaction(s) known to consume the compound == * RXN-11758 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DETHIOBIOTIN ==
+
== Metabolite Demethylated-Ubiquinols ==
 
* common-name:
 
* common-name:
** dethiobiotin
+
** a demethylated ubiquinol
* smiles:
 
** cc1(nc(=o)nc1cccccc(=o)[o-])
 
* inchi-key:
 
** autolbmxddtrrt-uhfffaoysa-m
 
* molecular-weight:
 
** 213.256
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.8.1.6-RXN]]
+
* [[RXN-11758]]
* [[RXN-17472]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DETHIOBIOTIN-SYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dethiobiotin}}
+
{{#set: common-name=a demethylated ubiquinol}}
{{#set: inchi-key=inchikey=autolbmxddtrrt-uhfffaoysa-m}}
 
{{#set: molecular-weight=213.256}}
 

Revision as of 18:52, 14 January 2021

Metabolite Demethylated-Ubiquinols

  • common-name:
    • a demethylated ubiquinol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality