Difference between revisions of "TRNA-uridine-38-40"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21995 == * transcription-direction: ** negative * right-end-position: ** 168394 * left-end-position: ** 167741 * centisome-position: ** 91.82835...")
(Created page with "Category:metabolite == Metabolite CPD-15364 == * common-name: ** ricinoleoyl-coa * smiles: ** ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ21995 ==
+
== Metabolite CPD-15364 ==
* transcription-direction:
+
* common-name:
** negative
+
** ricinoleoyl-coa
* right-end-position:
+
* smiles:
** 168394
+
** ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 167741
+
** bhvzcckrrpyxcv-mgnvxpimsa-j
* centisome-position:
+
* molecular-weight:
** 91.82835   
+
** 1043.952
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-14492]]
== Reaction(s) associated ==
+
* [[RXN-16151]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-16151]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
{{#set: transcription-direction=negative}}
+
{{#set: common-name=ricinoleoyl-coa}}
{{#set: right-end-position=168394}}
+
{{#set: inchi-key=inchikey=bhvzcckrrpyxcv-mgnvxpimsa-j}}
{{#set: left-end-position=167741}}
+
{{#set: molecular-weight=1043.952}}
{{#set: centisome-position=91.82835    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-15364

  • common-name:
    • ricinoleoyl-coa
  • smiles:
    • ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • bhvzcckrrpyxcv-mgnvxpimsa-j
  • molecular-weight:
    • 1043.952

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality