Difference between revisions of "TRNA-uridine13"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1083 == * common-name: ** (e)-2-methylcrotonoyl-coa * smiles: ** cc=c(c)c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-...") |
(Created page with "Category:metabolite == Metabolite CPD-16817 == * common-name: ** indoxyl sulfate * smiles: ** c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2)) * inchi-key: ** bxffhsidqofmle-uhfffa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-16817 == |
* common-name: | * common-name: | ||
| − | ** | + | ** indoxyl sulfate |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bxffhsidqofmle-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 212.2 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-15587]] | |
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-15587]] | |
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=indoxyl sulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bxffhsidqofmle-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=212.2}} |
Revision as of 11:15, 15 January 2021
Contents
Metabolite CPD-16817
- common-name:
- indoxyl sulfate
- smiles:
- c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2))
- inchi-key:
- bxffhsidqofmle-uhfffaoysa-m
- molecular-weight:
- 212.2
