Difference between revisions of "TRNA-uridine13"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-16817 == * common-name: ** indoxyl sulfate * smiles: ** c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2)) * inchi-key: ** bxffhsidqofmle-uhfffa...")
(Created page with "Category:metabolite == Metabolite tRNA-uridine13 == * common-name: ** a uridine13 in trna == Reaction(s) known to consume the compound == * RXN-11841 == Reaction(s) kn...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-16817 ==
+
== Metabolite tRNA-uridine13 ==
 
* common-name:
 
* common-name:
** indoxyl sulfate
+
** a uridine13 in trna
* smiles:
 
** c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2))
 
* inchi-key:
 
** bxffhsidqofmle-uhfffaoysa-m
 
* molecular-weight:
 
** 212.2
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15587]]
+
* [[RXN-11841]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15587]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=indoxyl sulfate}}
+
{{#set: common-name=a uridine13 in trna}}
{{#set: inchi-key=inchikey=bxffhsidqofmle-uhfffaoysa-m}}
 
{{#set: molecular-weight=212.2}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite tRNA-uridine13

  • common-name:
    • a uridine13 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality