Difference between revisions of "TRNA-uridine34"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-1718 == * common-name: ** 7,8-dihydropterin * smiles: ** c1(=nc2(=c(nc1)n=c(n)nc(=o)2)) * inchi-key: ** pxzwkvixskscfr-uhfffaoysa-n...") |
(Created page with "Category:metabolite == Metabolite tRNA-uridine34 == * common-name: ** a uridine34 in trna == Reaction(s) known to consume the compound == * RXN-16820 * RXN0-2023 =...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-uridine34 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a uridine34 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16820]] |
| + | * [[RXN0-2023]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a uridine34 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite tRNA-uridine34
- common-name:
- a uridine34 in trna
