Difference between revisions of "TRNA-uridine55"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...")
(Created page with "Category:metabolite == Metabolite tRNA-uridine55 == * common-name: ** a uridine55 in trna == Reaction(s) known to consume the compound == * RXN-11839 == Reaction(s) kn...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-365 ==
+
== Metabolite tRNA-uridine55 ==
 
* common-name:
 
* common-name:
** 1-keto-d-chiro-inositol
+
** a uridine55 in trna
* smiles:
 
** c1(o)(c(o)c(o)c(=o)c(o)c(o)1)
 
* inchi-key:
 
** vyegbdhsghxogt-qfycrykcsa-n
 
* molecular-weight:
 
** 178.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14148]]
+
* [[RXN-11839]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14148]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-keto-d-chiro-inositol}}
+
{{#set: common-name=a uridine55 in trna}}
{{#set: inchi-key=inchikey=vyegbdhsghxogt-qfycrykcsa-n}}
 
{{#set: molecular-weight=178.141}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite tRNA-uridine55

  • common-name:
    • a uridine55 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality