Difference between revisions of "TRNA-uridine55"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-365 == * common-name: ** 1-keto-d-chiro-inositol * smiles: ** c1(o)(c(o)c(o)c(=o)c(o)c(o)1) * inchi-key: ** vyegbdhsghxogt-qfycrykcsa...") |
(Created page with "Category:metabolite == Metabolite tRNA-uridine55 == * common-name: ** a uridine55 in trna == Reaction(s) known to consume the compound == * RXN-11839 == Reaction(s) kn...") |
||
(4 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite tRNA-uridine55 == |
* common-name: | * common-name: | ||
− | ** | + | ** a uridine55 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11839]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a uridine55 in trna}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite tRNA-uridine55
- common-name:
- a uridine55 in trna