Difference between revisions of "TRNA-uridine55"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-5-TRISPHOSPHATE == * common-name: ** d-myo-inositol (1,4,5)-trisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)...")
(Created page with "Category:metabolite == Metabolite 3-Prime-Phosphate-Terminated-RNAs == * common-name: ** an [rna]-3'-ribonucleoside-3'-phosphate == Reaction(s) known to consume the compou...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite INOSITOL-1-4-5-TRISPHOSPHATE ==
+
== Metabolite 3-Prime-Phosphate-Terminated-RNAs ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,4,5)-trisphosphate
+
** an [rna]-3'-ribonucleoside-3'-phosphate
* smiles:
 
** c1(o)(c(op([o-])([o-])=o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
 
* inchi-key:
 
** mmwciqzxvozegg-xjtpdsdzsa-h
 
* molecular-weight:
 
** 414.049
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.1.127-RXN]]
+
* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
* [[2.7.1.151-RXN]]
 
* [[3.1.3.56-RXN]]
 
* [[RXN-10948]]
 
* [[RXN-13197]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.1.4.11-RXN]]
 
* [[RXN-10948]]
 
* [[RXN-13197]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,4,5)-trisphosphate}}
+
{{#set: common-name=an [rna]-3'-ribonucleoside-3'-phosphate}}
{{#set: inchi-key=inchikey=mmwciqzxvozegg-xjtpdsdzsa-h}}
 
{{#set: molecular-weight=414.049}}
 

Revision as of 18:55, 14 January 2021

Metabolite 3-Prime-Phosphate-Terminated-RNAs

  • common-name:
    • an [rna]-3'-ribonucleoside-3'-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an [rna]-3'-ribonucleoside-3'-phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.