Difference between revisions of "TRNA-uridine65"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4205 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])...")
(Created page with "Category:metabolite == Metabolite tRNA-uridine65 == * common-name: ** a uridine65 in trna == Reaction(s) known to consume the compound == * RXN-11840 == Reaction(s) kn...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4205 ==
+
== Metabolite tRNA-uridine65 ==
 
* common-name:
 
* common-name:
** n6-(δ2-isopentenyl)-adenosine 5'-monophosphate
+
** a uridine65 in trna
* smiles:
 
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c
 
* inchi-key:
 
** duiszflwbaprbr-sdbhatresa-l
 
* molecular-weight:
 
** 413.326
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4311]]
+
* [[RXN-11840]]
* [[RXN-4313]]
 
* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
 
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4307]]
 
* [[RXN-4311]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-monophosphate}}
+
{{#set: common-name=a uridine65 in trna}}
{{#set: inchi-key=inchikey=duiszflwbaprbr-sdbhatresa-l}}
 
{{#set: molecular-weight=413.326}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite tRNA-uridine65

  • common-name:
    • a uridine65 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality