Difference between revisions of "TRNA-uridines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * smiles: ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite CPD-8609 == * common-name: ** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)(c(c2(=c(cc1)c3(c)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2106 ==
+
== Metabolite CPD-8609 ==
 
* common-name:
 
* common-name:
** 3-oxooctanoyl-coa
+
** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
 
* smiles:
 
* smiles:
** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)cccc([ch]4(c1(c)(c(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))=cc4)))c
 
* inchi-key:
 
* inchi-key:
** wpivbcgrgvnddt-cecatxlmsa-j
+
** ogqjuyxfioftma-pbjlwwpksa-n
 
* molecular-weight:
 
* molecular-weight:
** 903.684
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[RXN66-14]]
* [[RXN-14277]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[RXN-13707]]
* [[RXN-14275]]
+
* [[RXN66-13]]
* [[RXN-14277]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxooctanoyl-coa}}
+
{{#set: common-name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}}
{{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}}
+
{{#set: inchi-key=inchikey=ogqjuyxfioftma-pbjlwwpksa-n}}
{{#set: molecular-weight=903.684}}
+
{{#set: molecular-weight=412.698}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-8609

  • common-name:
    • 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
  • smiles:
    • cc(c)cccc([ch]4(c1(c)(c(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))=cc4)))c
  • inchi-key:
    • ogqjuyxfioftma-pbjlwwpksa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality