Difference between revisions of "TRNA-uridines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2106 == * common-name: ** 3-oxooctanoyl-coa * smiles: ** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(...")
(Created page with "Category:metabolite == Metabolite tRNA-uridines == * common-name: ** a uridine in trna == Reaction(s) known to consume the compound == * RXN0-1281 == Reaction(s) known...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2106 ==
+
== Metabolite tRNA-uridines ==
 
* common-name:
 
* common-name:
** 3-oxooctanoyl-coa
+
** a uridine in trna
* smiles:
 
** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** wpivbcgrgvnddt-cecatxlmsa-j
 
* molecular-weight:
 
** 903.684
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
+
* [[RXN0-1281]]
* [[RXN-14277]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
 
* [[RXN-14275]]
 
* [[RXN-14277]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxooctanoyl-coa}}
+
{{#set: common-name=a uridine in trna}}
{{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}}
 
{{#set: molecular-weight=903.684}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite tRNA-uridines

  • common-name:
    • a uridine in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality