Difference between revisions of "TRNA-uridines"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROSTAGLANDIN-E-SYNTHASE-RXN PROSTAGLANDIN-E-SYNTHASE-RXN] == * direction: ** left-to-right * commo...") |
(Created page with "Category:metabolite == Metabolite CPD-15035 == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine * smiles: ** cc(=o)nc2(...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15035 == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=o)nc2(c(oc1(oc(c(=o)[o-])=cc(o)c(os([o-])(=o)=o)1))c(o)c(co)oc(o)2) |
| − | == | + | * inchi-key: |
| − | + | ** zeucjyoqjtzlfj-rbcdgzsosa-l | |
| − | == | + | * molecular-weight: |
| − | * | + | ** 457.362 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-14021]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine}} | |
| − | == | + | {{#set: inchi-key=inchikey=zeucjyoqjtzlfj-rbcdgzsosa-l}} |
| − | + | {{#set: molecular-weight=457.362}} | |
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-15035
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-2-sulfate-(1,3)-n-acetyl-β-d-galactosamine
- smiles:
- cc(=o)nc2(c(oc1(oc(c(=o)[o-])=cc(o)c(os([o-])(=o)=o)1))c(o)c(co)oc(o)2)
- inchi-key:
- zeucjyoqjtzlfj-rbcdgzsosa-l
- molecular-weight:
- 457.362
