Difference between revisions of "TRNA-with-5-taurinomethyl-2-thiouridine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01092 == * transcription-direction: ** negative * right-end-position: ** 161783 * left-end-position: ** 156847 * centisome-position: ** 14.156517...")
(Created page with "Category:metabolite == Metabolite CYS-GLY == * common-name: ** l-cysteinyl-glycine * smiles: ** c(c([o-])=o)nc(c(cs)[n+])=o * inchi-key: ** zukpvrwzdmrieo-vkhmyheasa-n * m...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ01092 ==
+
== Metabolite CYS-GLY ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** l-cysteinyl-glycine
−
* right-end-position:
+
* smiles:
−
** 161783
+
** c(c([o-])=o)nc(c(cs)[n+])=o
−
* left-end-position:
+
* inchi-key:
−
** 156847
+
** zukpvrwzdmrieo-vkhmyheasa-n
−
* centisome-position:
+
* molecular-weight:
−
** 14.156517   
+
** 178.206
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-6622]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[RXN-12618]]
−
* [[1.1.1.145-RXN]]
+
* [[RXN-18092]]
−
** Category: [[annotation]]
+
* [[RXN-6601]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-9157]]
−
* [[RXN-12693]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=l-cysteinyl-glycine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=zukpvrwzdmrieo-vkhmyheasa-n}}
−
* [[RXN-12747]]
+
{{#set: molecular-weight=178.206}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12789]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-342]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-350]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN66-353]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6946]]
 
−
** '''6''' reactions found over '''22''' reactions in the full pathway
 
−
* [[PWY-6944]]
 
−
** '''2''' reactions found over '''25''' reactions in the full pathway
 
−
* [[PWY-6948]]
 
−
** '''2''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY66-378]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7299]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-4861]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-6415]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=161783}}
 
−
{{#set: left-end-position=156847}}
 
−
{{#set: centisome-position=14.156517    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=8}}
 
−
{{#set: nb pathway associated=7}}
 

Revision as of 20:34, 18 December 2020

Metabolite CYS-GLY

  • common-name:
    • l-cysteinyl-glycine
  • smiles:
    • c(c([o-])=o)nc(c(cs)[n+])=o
  • inchi-key:
    • zukpvrwzdmrieo-vkhmyheasa-n
  • molecular-weight:
    • 178.206

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNA-with-5-taurinomethyl-2-thiouridine&oldid=47118"