Difference between revisions of "TRNA-with-7-aminomethyl-7-deazaguanine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13398 == * common-name: ** l-alanyl-l-leucine * smiles: ** cc(c)cc(c([o-])=o)nc(c(c)[n+])=o * inchi-key: ** rdikfprvljlmer-bqbzgakwsa...") |
(Created page with "Category:metabolite == Metabolite tRNA-with-7-aminomethyl-7-deazaguanine == * common-name: ** a 7-aminomethyl-7-deazaguanosine34 in trna == Reaction(s) known to consume th...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-with-7-aminomethyl-7-deazaguanine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 7-aminomethyl-7-deazaguanosine34 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-1321]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 7-aminomethyl-7-deazaguanosine34 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite tRNA-with-7-aminomethyl-7-deazaguanine
- common-name:
- a 7-aminomethyl-7-deazaguanosine34 in trna
