Difference between revisions of "TRNA-with-7-aminomethyl-7-deazaguanine"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13868 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * s...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == |
| − | + | * common-name: | |
| − | * | + | ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate |
| − | = | + | * smiles: |
| − | + | ** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2) | |
| − | * | + | * inchi-key: |
| − | ** | + | ** bujztfindcqrgp-ztvljyeesa-l |
| − | * | + | * molecular-weight: |
| − | + | ** 457.362 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | == | + | * [[RXN-12177]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}} |
| − | {{#set: | + | {{#set: molecular-weight=457.362}} |
Revision as of 20:33, 18 December 2020
Contents
Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S
- common-name:
- 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
- smiles:
- cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
- inchi-key:
- bujztfindcqrgp-ztvljyeesa-l
- molecular-weight:
- 457.362
