Difference between revisions of "TRNA-with-7-aminomethyl-7-deazaguanine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * s...") |
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GAMA-TOCOPHEROL == |
* common-name: | * common-name: | ||
− | ** | + | ** γ-tocopherol |
* smiles: | * smiles: | ||
− | ** cc( | + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** quedxnhftdjviy-dqczwyhmsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 416.686 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=γ-tocopherol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=416.686}} |
Revision as of 14:56, 5 January 2021
Contents
Metabolite GAMA-TOCOPHEROL
- common-name:
- γ-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
- inchi-key:
- quedxnhftdjviy-dqczwyhmsa-n
- molecular-weight:
- 416.686