Difference between revisions of "TRNA-with-7-aminomethyl-7-deazaguanine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * s...")
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S ==
+
== Metabolite GAMA-TOCOPHEROL ==
 
* common-name:
 
* common-name:
−
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
+
** γ-tocopherol
 
* smiles:
 
* smiles:
−
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
+
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
 
* inchi-key:
 
* inchi-key:
−
** bujztfindcqrgp-ztvljyeesa-l
+
** quedxnhftdjviy-dqczwyhmsa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 457.362
+
** 416.686
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12177]]
+
* [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}}
+
{{#set: common-name=γ-tocopherol}}
−
{{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}}
+
{{#set: inchi-key=inchikey=quedxnhftdjviy-dqczwyhmsa-n}}
−
{{#set: molecular-weight=457.362}}
+
{{#set: molecular-weight=416.686}}

Revision as of 14:56, 5 January 2021

Metabolite GAMA-TOCOPHEROL

  • common-name:
    • γ-tocopherol
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c))
  • inchi-key:
    • quedxnhftdjviy-dqczwyhmsa-n
  • molecular-weight:
    • 416.686

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TRNA-with-7-aminomethyl-7-deazaguanine&oldid=59846"